C11H13Br2NO3 — CID 107729059
N-(1,3-dibromo-2-methylpropan-2-yl)-3,4-dihydroxybenzamide (PubChem CID 107729059) has the molecular formula C11H13Br2NO3 and a molecular weight of 367.04 g/mol. Its IUPAC name is N-(1,3-dibromo-2-methylpropan-2-yl)-3,4-dihydroxybenzamide.
| Compound Name | N-(1,3-dibromo-2-methylpropan-2-yl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 107729059 |
| Molecular Formula | C11H13Br2NO3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | N-(1,3-dibromo-2-methylpropan-2-yl)-3,4-dihydroxybenzamide |
| SMILES | CC(CBr)(CBr)NC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H13Br2NO3/c1-11(5-12,6-13)14-10(17)7-2-3-8(15)9(16)4-7/h2-4,15-16H,5-6H2,1H3,(H,14,17) |
| InChIKey | DKPORNCLUSNWTD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|