C13H9BrF2N2O2 — CID 107729211
N-(5-amino-2,4-difluorophenyl)-5-bromo-2-hydroxybenzamide (PubChem CID 107729211) has the molecular formula C13H9BrF2N2O2 and a molecular weight of 343.13 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)-5-bromo-2-hydroxybenzamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)-5-bromo-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107729211 |
| Molecular Formula | C13H9BrF2N2O2 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)-5-bromo-2-hydroxybenzamide |
| SMILES | Nc1cc(NC(=O)c2cc(Br)ccc2O)c(F)cc1F |
| InChI | InChI=1S/C13H9BrF2N2O2/c14-6-1-2-12(19)7(3-6)13(20)18-11-5-10(17)8(15)4-9(11)16/h1-5,19H,17H2,(H,18,20) |
| InChIKey | ATTBXOOSFYUTEL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|