About (2S,3S)-3-methylpentane-1,2-diol
(2S,3S)-3-methylpentane-1,2-diol (PubChem CID 10772963) has the molecular formula C6H14O2
and a molecular weight of 118.18 g/mol. Its IUPAC name is (2S,3S)-3-methylpentane-1,2-diol.
Molecular Properties
| Compound Name | (2S,3S)-3-methylpentane-1,2-diol |
| PubChem CID | 10772963 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | (2S,3S)-3-methylpentane-1,2-diol |
| SMILES | CC[C@H](C)[C@H](O)CO |
| InChI | InChI=1S/C6H14O2/c1-3-5(2)6(8)4-7/h5-8H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | OGLLAZUAZSIDFE-NTSWFWBYSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-3-methylpentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-methylpentane-1,2-diol?
The IUPAC name of (2S,3S)-3-methylpentane-1,2-diol (CID 10772963) is (2S,3S)-3-methylpentane-1,2-diol.
What is the SMILES notation for (2S,3S)-3-methylpentane-1,2-diol?
The canonical SMILES for (2S,3S)-3-methylpentane-1,2-diol is CC[C@H](C)[C@H](O)CO.
What is the InChIKey of (2S,3S)-3-methylpentane-1,2-diol?
The InChIKey is OGLLAZUAZSIDFE-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H14O2/c1-3-5(2)6(8)4-7/h5-8H,3-4H2,1-2H3/t5-,6+/m0/s1.
What are the key properties of (2S,3S)-3-methylpentane-1,2-diol?
(2S,3S)-3-methylpentane-1,2-diol has a molecular weight of 118.18 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methylpentane-1,2-diol is sourced from PubChem (CID 10772963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).