C14H10BrF2NO2 — CID 107729819
5-bromo-N-(2,6-difluoro-3-methylphenyl)-2-hydroxybenzamide (PubChem CID 107729819) has the molecular formula C14H10BrF2NO2 and a molecular weight of 342.14 g/mol. Its IUPAC name is 5-bromo-N-(2,6-difluoro-3-methylphenyl)-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-(2,6-difluoro-3-methylphenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107729819 |
| Molecular Formula | C14H10BrF2NO2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 5-bromo-N-(2,6-difluoro-3-methylphenyl)-2-hydroxybenzamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2cc(Br)ccc2O)c1F |
| InChI | InChI=1S/C14H10BrF2NO2/c1-7-2-4-10(16)13(12(7)17)18-14(20)9-6-8(15)3-5-11(9)19/h2-6,19H,1H3,(H,18,20) |
| InChIKey | ZGCUCJHBCKUINZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |