C14H16N2O3 — CID 107730940
4-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]benzene-1,2,3-triol (PubChem CID 107730940) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 107730940 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]benzene-1,2,3-triol |
| SMILES | C[C@@H](NCc1ccc(O)c(O)c1O)c1ccncc1 |
| InChI | InChI=1S/C14H16N2O3/c1-9(10-4-6-15-7-5-10)16-8-11-2-3-12(17)14(19)13(11)18/h2-7,9,16-19H,8H2,1H3/t9-/m1/s1 |
| InChIKey | QGKLHFIWTOQRGB-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|