C14H16INO4S — CID 107731343
3-(2-hydroxy-5-iodobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 107731343) has the molecular formula C14H16INO4S and a molecular weight of 421.26 g/mol. Its IUPAC name is 3-(2-hydroxy-5-iodobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(2-hydroxy-5-iodobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107731343 |
| Molecular Formula | C14H16INO4S |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 3-(2-hydroxy-5-iodobenzoyl)-2-propyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCC1SCC(C(=O)O)N1C(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C14H16INO4S/c1-2-3-12-16(10(7-21-12)14(19)20)13(18)9-6-8(15)4-5-11(9)17/h4-6,10,12,17H,2-3,7H2,1H3,(H,19,20) |
| InChIKey | NQTNYSZTMVLUAJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|