C10H12N4O3S — CID 107733444
5-amino-N-(3-hydroxyphenyl)-N-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 107733444) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxyphenyl)-N-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(3-hydroxyphenyl)-N-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 107733444 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-amino-N-(3-hydroxyphenyl)-N-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CN(c1cccc(O)c1)S(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C10H12N4O3S/c1-14(7-3-2-4-8(15)5-7)18(16,17)9-6-12-13-10(9)11/h2-6,15H,1H3,(H3,11,12,13) |
| InChIKey | GTEGNGDVZSEEHT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |