C8H7NO3 — CID 10773345
5-(furan-2-yl)-4-methyl-1,2-oxazol-3-one (PubChem CID 10773345) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 5-(furan-2-yl)-4-methyl-1,2-oxazol-3-one.
| Compound Name | 5-(furan-2-yl)-4-methyl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 10773345 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-(furan-2-yl)-4-methyl-1,2-oxazol-3-one |
| SMILES | Cc1c(-c2ccco2)o[nH]c1=O |
| InChI | InChI=1S/C8H7NO3/c1-5-7(12-9-8(5)10)6-3-2-4-11-6/h2-4H,1H3,(H,9,10) |
| InChIKey | LYESODVARGIZAN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |