About 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol
3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol (PubChem CID 107733638) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol.
Molecular Properties
| Compound Name | 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol |
| PubChem CID | 107733638 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol |
| SMILES | CCN(c1cc(O)ccc1C)c1cc(C)nc(C)c1CN |
| InChI | InChI=1S/C17H23N3O/c1-5-20(16-9-14(21)7-6-11(16)2)17-8-12(3)19-13(4)15(17)10-18/h6-9,21H,5,10,18H2,1-4H3 |
| InChIKey | QEMHRCPPXBXBPK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol?
The IUPAC name of 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol (CID 107733638) is 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol.
What is the SMILES notation for 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol?
The canonical SMILES for 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol is CCN(c1cc(O)ccc1C)c1cc(C)nc(C)c1CN.
What is the InChIKey of 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol?
The InChIKey is QEMHRCPPXBXBPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-5-20(16-9-14(21)7-6-11(16)2)17-8-12(3)19-13(4)15(17)10-18/h6-9,21H,5,10,18H2,1-4H3.
What are the key properties of 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol?
3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol has a molecular weight of 285.39 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(aminomethyl)-2,6-dimethyl-4-pyridinyl]-ethylamino]-4-methylphenol is sourced from PubChem (CID 107733638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).