C25H21N5O3 — CID 1077340
7-(furan-2-ylmethyl)-6-imino-2-oxo-N-[(1R)-1-phenylethyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide (PubChem CID 1077340) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 7-(furan-2-ylmethyl)-6-imino-2-oxo-N-[(1R)-1-phenylethyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide.
| Compound Name | 7-(furan-2-ylmethyl)-6-imino-2-oxo-N-[(1R)-1-phenylethyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 1077340 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 7-(furan-2-ylmethyl)-6-imino-2-oxo-N-[(1R)-1-phenylethyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxamide |
| SMILES | [H]/N=c1\c(C(=O)N[C@H](C)c2ccccc2)cc2c(=O)n3ccccc3nc2n1Cc1ccco1 |
| InChI | InChI=1S/C25H21N5O3/c1-16(17-8-3-2-4-9-17)27-24(31)19-14-20-23(28-21-11-5-6-12-29(21)25(20)32)30(22(19)26)15-18-10-7-13-33-18/h2-14,16,26H,15H2,1H3,(H,27,31)/b26-22+/t16-/m1/s1 |
| InChIKey | WBIIQCOUPMPNLG-RAFCBBKXSA-N |
| XLogP | 3.26 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|