About N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide
N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide (PubChem CID 107735052) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide |
| PubChem CID | 107735052 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide |
| SMILES | CCN(C(=O)C(=O)NCC#N)c1cc(O)ccc1C |
| InChI | InChI=1S/C13H15N3O3/c1-3-16(13(19)12(18)15-7-6-14)11-8-10(17)5-4-9(11)2/h4-5,8,17H,3,7H2,1-2H3,(H,15,18) |
| InChIKey | XDTGDWGYLSHARO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide?
The IUPAC name of N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide (CID 107735052) is N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide.
What is the SMILES notation for N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide?
The canonical SMILES for N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide is CCN(C(=O)C(=O)NCC#N)c1cc(O)ccc1C.
What is the InChIKey of N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide?
The InChIKey is XDTGDWGYLSHARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-3-16(13(19)12(18)15-7-6-14)11-8-10(17)5-4-9(11)2/h4-5,8,17H,3,7H2,1-2H3,(H,15,18).
What are the key properties of N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide?
N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide has a molecular weight of 261.28 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N'-ethyl-N'-(5-hydroxy-2-methylphenyl)oxamide is sourced from PubChem (CID 107735052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).