C14H14N2O2 — CID 107735739
N-(3-hydroxyphenyl)-N,2-dimethylpyridine-4-carboxamide (PubChem CID 107735739) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-N,2-dimethylpyridine-4-carboxamide.
| Compound Name | N-(3-hydroxyphenyl)-N,2-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107735739 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(3-hydroxyphenyl)-N,2-dimethylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)c2cccc(O)c2)ccn1 |
| InChI | InChI=1S/C14H14N2O2/c1-10-8-11(6-7-15-10)14(18)16(2)12-4-3-5-13(17)9-12/h3-9,17H,1-2H3 |
| InChIKey | NENGEGSMODGYKP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |