About (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one
(1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one (PubChem CID 10773668) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one.
Molecular Properties
| Compound Name | (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one |
| PubChem CID | 10773668 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one |
| SMILES | O=C1OC[C@@]23CC=CC[C@@]12CCC3 |
| InChI | InChI=1S/C11H14O2/c12-9-11-6-2-1-4-10(11,8-13-9)5-3-7-11/h1-2H,3-8H2/t10-,11+/m0/s1 |
| InChIKey | XRHNSHFFLNONMK-WDEREUQCSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one?
The IUPAC name of (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one (CID 10773668) is (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one.
What is the SMILES notation for (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one?
The canonical SMILES for (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one is O=C1OC[C@@]23CC=CC[C@@]12CCC3.
What is the InChIKey of (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one?
The InChIKey is XRHNSHFFLNONMK-WDEREUQCSA-N. The full InChI is InChI=1S/C11H14O2/c12-9-11-6-2-1-4-10(11,8-13-9)5-3-7-11/h1-2H,3-8H2/t10-,11+/m0/s1.
What are the key properties of (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one?
(1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one has a molecular weight of 178.23 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-8-oxatricyclo[4.3.3.01,6]dodec-3-en-7-one is sourced from PubChem (CID 10773668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).