C11H16O2 — CID 10773717
(3aS,6R,8aS)-6-methyl-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]furan-2-one (PubChem CID 10773717) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3aS,6R,8aS)-6-methyl-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]furan-2-one.
| Compound Name | (3aS,6R,8aS)-6-methyl-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 10773717 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3aS,6R,8aS)-6-methyl-3-methylidene-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@H]2CC[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C11H16O2/c1-7-3-5-9-8(2)11(12)13-10(9)6-4-7/h7,9-10H,2-6H2,1H3/t7-,9+,10+/m1/s1 |
| InChIKey | YPNHSXBOWJTVIS-JEZHCXPESA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|