C16H17BrClNO — CID 107737675
4-bromo-2-[[1-(2-chlorophenyl)propan-2-ylamino]methyl]phenol (PubChem CID 107737675) has the molecular formula C16H17BrClNO and a molecular weight of 354.68 g/mol. Its IUPAC name is 4-bromo-2-[[1-(2-chlorophenyl)propan-2-ylamino]methyl]phenol.
| Compound Name | 4-bromo-2-[[1-(2-chlorophenyl)propan-2-ylamino]methyl]phenol |
|---|---|
| PubChem CID | 107737675 |
| Molecular Formula | C16H17BrClNO |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4-bromo-2-[[1-(2-chlorophenyl)propan-2-ylamino]methyl]phenol |
| SMILES | CC(Cc1ccccc1Cl)NCc1cc(Br)ccc1O |
| InChI | InChI=1S/C16H17BrClNO/c1-11(8-12-4-2-3-5-15(12)18)19-10-13-9-14(17)6-7-16(13)20/h2-7,9,11,19-20H,8,10H2,1H3 |
| InChIKey | AKTFJAGUMVATCK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|