About methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate
methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate (PubChem CID 10773951) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate.
Analyze methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate?
The IUPAC name of methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate (CID 10773951) is methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate.
What is the SMILES notation for methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate?
The canonical SMILES for methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate is COC(=O)C1=C[C@@H](O)[C@@H](O)[C@H](O)C1.
What is the InChIKey of methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate?
The InChIKey is LSNUUAUXWJZSFD-FSDSQADBSA-N. The full InChI is InChI=1S/C8H12O5/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2,5-7,9-11H,3H2,1H3/t5-,6-,7-/m1/s1.
What are the key properties of methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate?
methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate has a molecular weight of 188.18 g/mol, XLogP of -1.43, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate is sourced from PubChem (CID 10773951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).