C13H17Br2NO2 — CID 107739535
2-[3,5-dibromo-4-(oxolan-3-ylmethoxy)phenyl]ethanamine (PubChem CID 107739535) has the molecular formula C13H17Br2NO2 and a molecular weight of 379.09 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-(oxolan-3-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-dibromo-4-(oxolan-3-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107739535 |
| Molecular Formula | C13H17Br2NO2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 2-[3,5-dibromo-4-(oxolan-3-ylmethoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(Br)c(OCC2CCOC2)c(Br)c1 |
| InChI | InChI=1S/C13H17Br2NO2/c14-11-5-9(1-3-16)6-12(15)13(11)18-8-10-2-4-17-7-10/h5-6,10H,1-4,7-8,16H2 |
| InChIKey | CUERSYUBYOBWNF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |