C14H20Br2N2O2 — CID 107739825
2-[4-(2-aminopropyl)-2,6-dibromophenoxy]-N-ethyl-N-methylacetamide (PubChem CID 107739825) has the molecular formula C14H20Br2N2O2 and a molecular weight of 408.13 g/mol. Its IUPAC name is 2-[4-(2-aminopropyl)-2,6-dibromophenoxy]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[4-(2-aminopropyl)-2,6-dibromophenoxy]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 107739825 |
| Molecular Formula | C14H20Br2N2O2 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 2-[4-(2-aminopropyl)-2,6-dibromophenoxy]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)COc1c(Br)cc(CC(C)N)cc1Br |
| InChI | InChI=1S/C14H20Br2N2O2/c1-4-18(3)13(19)8-20-14-11(15)6-10(5-9(2)17)7-12(14)16/h6-7,9H,4-5,8,17H2,1-3H3 |
| InChIKey | OCGWCMZXKLZXSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |