About N'-phenylbenzohydrazide
N'-phenylbenzohydrazide (PubChem CID 10774) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | N'-phenylbenzohydrazide |
| PubChem CID | 10774 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | N'-phenylbenzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O/c16-13(11-7-3-1-4-8-11)15-14-12-9-5-2-6-10-12/h1-10,14H,(H,15,16) |
| InChIKey | CKLPECFHCLIYKN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-phenylbenzohydrazide?
The IUPAC name of N'-phenylbenzohydrazide (CID 10774) is N'-phenylbenzohydrazide.
What is the SMILES notation for N'-phenylbenzohydrazide?
The canonical SMILES for N'-phenylbenzohydrazide is O=C(NNc1ccccc1)c1ccccc1.
What is the InChIKey of N'-phenylbenzohydrazide?
The InChIKey is CKLPECFHCLIYKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c16-13(11-7-3-1-4-8-11)15-14-12-9-5-2-6-10-12/h1-10,14H,(H,15,16).
What are the key properties of N'-phenylbenzohydrazide?
N'-phenylbenzohydrazide has a molecular weight of 212.25 g/mol, XLogP of 2.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-phenylbenzohydrazide is sourced from PubChem (CID 10774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).