About (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane
(1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane (PubChem CID 10774046) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane |
| PubChem CID | 10774046 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane |
| SMILES | CC1(c2ccccc2)C[C@H]2O[C@H]2CO1 |
| InChI | InChI=1S/C12H14O2/c1-12(9-5-3-2-4-6-9)7-10-11(14-10)8-13-12/h2-6,10-11H,7-8H2,1H3/t10-,11+,12?/m1/s1 |
| InChIKey | NJQODDMALVQCEE-UBNQGINQSA-N |
| XLogP | 2.09 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane?
The IUPAC name of (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane (CID 10774046) is (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane.
What is the SMILES notation for (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane?
The canonical SMILES for (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane is CC1(c2ccccc2)C[C@H]2O[C@H]2CO1.
What is the InChIKey of (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane?
The InChIKey is NJQODDMALVQCEE-UBNQGINQSA-N. The full InChI is InChI=1S/C12H14O2/c1-12(9-5-3-2-4-6-9)7-10-11(14-10)8-13-12/h2-6,10-11H,7-8H2,1H3/t10-,11+,12?/m1/s1.
What are the key properties of (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane?
(1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane has a molecular weight of 190.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-4-methyl-4-phenyl-3,7-dioxabicyclo[4.1.0]heptane is sourced from PubChem (CID 10774046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).