C13H9Br2ClN2O3 — CID 107741009
2,6-dibromo-4-[(3-chloro-4-nitroanilino)methyl]phenol (PubChem CID 107741009) has the molecular formula C13H9Br2ClN2O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2,6-dibromo-4-[(3-chloro-4-nitroanilino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(3-chloro-4-nitroanilino)methyl]phenol |
|---|---|
| PubChem CID | 107741009 |
| Molecular Formula | C13H9Br2ClN2O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 433.87 |
| IUPAC Name | 2,6-dibromo-4-[(3-chloro-4-nitroanilino)methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(NCc2cc(Br)c(O)c(Br)c2)cc1Cl |
| InChI | InChI=1S/C13H9Br2ClN2O3/c14-9-3-7(4-10(15)13(9)19)6-17-8-1-2-12(18(20)21)11(16)5-8/h1-5,17,19H,6H2 |
| InChIKey | QSCATUSDJABNTG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|