C19H15N5O3 — CID 1077411
methyl 6-imino-2-oxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 1077411) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is methyl 6-imino-2-oxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | methyl 6-imino-2-oxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 1077411 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl 6-imino-2-oxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | [H]/N=c1\c(C(=O)OC)cc2c(=O)n3ccccc3nc2n1Cc1cccnc1 |
| InChI | InChI=1S/C19H15N5O3/c1-27-19(26)13-9-14-17(22-15-6-2-3-8-23(15)18(14)25)24(16(13)20)11-12-5-4-7-21-10-12/h2-10,20H,11H2,1H3/b20-16+ |
| InChIKey | MCVRPCMOTQNFQJ-CAPFRKAQSA-N |
| XLogP | 1.36 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|