C12H9Br2FN2O — CID 107741109
2,6-dibromo-4-[[(6-fluoro-2-pyridinyl)amino]methyl]phenol (PubChem CID 107741109) has the molecular formula C12H9Br2FN2O and a molecular weight of 376.02 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(6-fluoro-2-pyridinyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(6-fluoro-2-pyridinyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 107741109 |
| Molecular Formula | C12H9Br2FN2O |
| Molecular Weight | 376.02 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 2,6-dibromo-4-[[(6-fluoro-2-pyridinyl)amino]methyl]phenol |
| SMILES | Oc1c(Br)cc(CNc2cccc(F)n2)cc1Br |
| InChI | InChI=1S/C12H9Br2FN2O/c13-8-4-7(5-9(14)12(8)18)6-16-11-3-1-2-10(15)17-11/h1-5,18H,6H2,(H,16,17) |
| InChIKey | CXHCPIBDNMBTDW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.02 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|