C13H17Br2NO — CID 107741117
2,6-dibromo-4-[[(3-methylcyclopentyl)amino]methyl]phenol (PubChem CID 107741117) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(3-methylcyclopentyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(3-methylcyclopentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 107741117 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 2,6-dibromo-4-[[(3-methylcyclopentyl)amino]methyl]phenol |
| SMILES | CC1CCC(NCc2cc(Br)c(O)c(Br)c2)C1 |
| InChI | InChI=1S/C13H17Br2NO/c1-8-2-3-10(4-8)16-7-9-5-11(14)13(17)12(15)6-9/h5-6,8,10,16-17H,2-4,7H2,1H3 |
| InChIKey | BVNLKRKMPUQFLE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |