C15H21Br2NO — CID 107741276
[3,5-dibromo-4-(2-ethylcyclohexyl)oxyphenyl]methanamine (PubChem CID 107741276) has the molecular formula C15H21Br2NO and a molecular weight of 391.15 g/mol. Its IUPAC name is [3,5-dibromo-4-(2-ethylcyclohexyl)oxyphenyl]methanamine.
| Compound Name | [3,5-dibromo-4-(2-ethylcyclohexyl)oxyphenyl]methanamine |
|---|---|
| PubChem CID | 107741276 |
| Molecular Formula | C15H21Br2NO |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | [3,5-dibromo-4-(2-ethylcyclohexyl)oxyphenyl]methanamine |
| SMILES | CCC1CCCCC1Oc1c(Br)cc(CN)cc1Br |
| InChI | InChI=1S/C15H21Br2NO/c1-2-11-5-3-4-6-14(11)19-15-12(16)7-10(9-18)8-13(15)17/h7-8,11,14H,2-6,9,18H2,1H3 |
| InChIKey | BMYSBYKVTZHZST-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |