About (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one
(3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one (PubChem CID 10774144) has the molecular formula C8H10F3NO
and a molecular weight of 193.17 g/mol. Its IUPAC name is (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one.
Molecular Properties
| Compound Name | (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one |
| PubChem CID | 10774144 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one |
| SMILES | CN1CCC/C(=C\C(F)(F)F)C1=O |
| InChI | InChI=1S/C8H10F3NO/c1-12-4-2-3-6(7(12)13)5-8(9,10)11/h5H,2-4H2,1H3/b6-5+ |
| InChIKey | LALANJQVSPFJFC-AATRIKPKSA-N |
| XLogP | 1.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one?
The IUPAC name of (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one (CID 10774144) is (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one.
What is the SMILES notation for (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one?
The canonical SMILES for (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one is CN1CCC/C(=C\C(F)(F)F)C1=O.
What is the InChIKey of (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one?
The InChIKey is LALANJQVSPFJFC-AATRIKPKSA-N. The full InChI is InChI=1S/C8H10F3NO/c1-12-4-2-3-6(7(12)13)5-8(9,10)11/h5H,2-4H2,1H3/b6-5+.
What are the key properties of (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one?
(3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one has a molecular weight of 193.17 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-methyl-3-(2,2,2-trifluoroethylidene)piperidin-2-one is sourced from PubChem (CID 10774144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).