About 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid
6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid (PubChem CID 10774314) has the molecular formula C6H5F3O4
and a molecular weight of 198.10 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid |
| PubChem CID | 10774314 |
| Molecular Formula | C6H5F3O4 |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid |
| SMILES | O=C(O)C1=C(C(F)(F)F)OCCO1 |
| InChI | InChI=1S/C6H5F3O4/c7-6(8,9)4-3(5(10)11)12-1-2-13-4/h1-2H2,(H,10,11) |
| InChIKey | PNYSXJBWUVGNQW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid?
The IUPAC name of 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid (CID 10774314) is 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid.
What is the SMILES notation for 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid?
The canonical SMILES for 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid is O=C(O)C1=C(C(F)(F)F)OCCO1.
What is the InChIKey of 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid?
The InChIKey is PNYSXJBWUVGNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3O4/c7-6(8,9)4-3(5(10)11)12-1-2-13-4/h1-2H2,(H,10,11).
What are the key properties of 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid?
6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid has a molecular weight of 198.10 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-2,3-dihydro-1,4-dioxine-5-carboxylic acid is sourced from PubChem (CID 10774314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).