C15H23NO3 — CID 107743173
[3-methoxy-4-(2-piperidin-2-ylethoxy)phenyl]methanol (PubChem CID 107743173) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is [3-methoxy-4-(2-piperidin-2-ylethoxy)phenyl]methanol.
| Compound Name | [3-methoxy-4-(2-piperidin-2-ylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107743173 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [3-methoxy-4-(2-piperidin-2-ylethoxy)phenyl]methanol |
| SMILES | COc1cc(CO)ccc1OCCC1CCCCN1 |
| InChI | InChI=1S/C15H23NO3/c1-18-15-10-12(11-17)5-6-14(15)19-9-7-13-4-2-3-8-16-13/h5-6,10,13,16-17H,2-4,7-9,11H2,1H3 |
| InChIKey | ILQXNPCHQUGLFU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |