C14H15N3O3 — CID 107743265
6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-3-carboximidamide (PubChem CID 107743265) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-3-carboximidamide.
| Compound Name | 6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107743265 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2ccc(CO)cc2OC)nc1 |
| InChI | InChI=1S/C14H15N3O3/c1-19-12-6-9(8-18)2-4-11(12)20-13-5-3-10(7-17-13)14(15)16/h2-7,18H,8H2,1H3,(H3,15,16) |
| InChIKey | JQOUIWHCRLOLAC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|