C14H14N2O5 — CID 107744136
5-amino-6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-2-carboxylic acid (PubChem CID 107744136) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-amino-6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 107744136 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-amino-6-[4-(hydroxymethyl)-2-methoxyphenoxy]pyridine-2-carboxylic acid |
| SMILES | COc1cc(CO)ccc1Oc1nc(C(=O)O)ccc1N |
| InChI | InChI=1S/C14H14N2O5/c1-20-12-6-8(7-17)2-5-11(12)21-13-9(15)3-4-10(16-13)14(18)19/h2-6,17H,7,15H2,1H3,(H,18,19) |
| InChIKey | GORIHLATYAWAIJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |