C13H19N3O4 — CID 107744863
3-amino-N-(2-hydroxy-5-nitrophenyl)-2,2,3-trimethylbutanamide (PubChem CID 107744863) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxy-5-nitrophenyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(2-hydroxy-5-nitrophenyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 107744863 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-amino-N-(2-hydroxy-5-nitrophenyl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C13H19N3O4/c1-12(2,13(3,4)14)11(18)15-9-7-8(16(19)20)5-6-10(9)17/h5-7,17H,14H2,1-4H3,(H,15,18) |
| InChIKey | FDGGPCDFSCZCHV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|