C14H18N4O3 — CID 107745130
[4-[2-amino-6-(ethylamino)pyrimidin-4-yl]oxy-3-methoxyphenyl]methanol (PubChem CID 107745130) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is [4-[2-amino-6-(ethylamino)pyrimidin-4-yl]oxy-3-methoxyphenyl]methanol.
| Compound Name | [4-[2-amino-6-(ethylamino)pyrimidin-4-yl]oxy-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 107745130 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [4-[2-amino-6-(ethylamino)pyrimidin-4-yl]oxy-3-methoxyphenyl]methanol |
| SMILES | CCNc1cc(Oc2ccc(CO)cc2OC)nc(N)n1 |
| InChI | InChI=1S/C14H18N4O3/c1-3-16-12-7-13(18-14(15)17-12)21-10-5-4-9(8-19)6-11(10)20-2/h4-7,19H,3,8H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | DDEKWCPDSFXFIY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |