C14H12Br3NO2 — CID 107745738
2-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-6-methoxypyridine (PubChem CID 107745738) has the molecular formula C14H12Br3NO2 and a molecular weight of 465.97 g/mol. Its IUPAC name is 2-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-6-methoxypyridine.
| Compound Name | 2-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-6-methoxypyridine |
|---|---|
| PubChem CID | 107745738 |
| Molecular Formula | C14H12Br3NO2 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 462.84 |
| IUPAC Name | 2-[[2,6-dibromo-4-(bromomethyl)phenoxy]methyl]-6-methoxypyridine |
| SMILES | COc1cccc(COc2c(Br)cc(CBr)cc2Br)n1 |
| InChI | InChI=1S/C14H12Br3NO2/c1-19-13-4-2-3-10(18-13)8-20-14-11(16)5-9(7-15)6-12(14)17/h2-6H,7-8H2,1H3 |
| InChIKey | AOSWABBSDYCUCZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|