About 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane
3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane (PubChem CID 107746976) has the molecular formula C8H12BrF3O3S
and a molecular weight of 325.15 g/mol. Its IUPAC name is 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane.
Molecular Properties
| Compound Name | 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane |
| PubChem CID | 107746976 |
| Molecular Formula | C8H12BrF3O3S |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane |
| SMILES | CC1OCCC1S(=O)(=O)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C8H12BrF3O3S/c1-5-6(2-3-15-5)16(13,14)4-7(9)8(10,11)12/h5-7H,2-4H2,1H3 |
| InChIKey | GKDVYMIULIHHGH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane?
The IUPAC name of 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane (CID 107746976) is 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane.
What is the SMILES notation for 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane?
The canonical SMILES for 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane is CC1OCCC1S(=O)(=O)CC(Br)C(F)(F)F.
What is the InChIKey of 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane?
The InChIKey is GKDVYMIULIHHGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrF3O3S/c1-5-6(2-3-15-5)16(13,14)4-7(9)8(10,11)12/h5-7H,2-4H2,1H3.
What are the key properties of 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane?
3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane has a molecular weight of 325.15 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methyloxolane is sourced from PubChem (CID 107746976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).