C7H4N4O4 — CID 10774715
7-nitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 10774715) has the molecular formula C7H4N4O4 and a molecular weight of 208.13 g/mol. Its IUPAC name is 7-nitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-nitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 10774715 |
| Molecular Formula | C7H4N4O4 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 7-nitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cnc2[nH]c1=O |
| InChI | InChI=1S/C7H4N4O4/c12-6-7(13)10-5-4(9-6)1-3(2-8-5)11(14)15/h1-2H,(H,9,12)(H,8,10,13) |
| InChIKey | FZAAGBYLDXVMRM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|