About (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine
(2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine (PubChem CID 10774796) has the molecular formula C11H12F2N2
and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine |
| PubChem CID | 10774796 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine |
| SMILES | C[C@@H](N)Cn1ccc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C11H12F2N2/c1-7(14)6-15-3-2-8-4-9(12)10(13)5-11(8)15/h2-5,7H,6,14H2,1H3/t7-/m1/s1 |
| InChIKey | MYZDBEVPJGKIQS-SSDOTTSWSA-N |
| XLogP | 2.27 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine?
The IUPAC name of (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine (CID 10774796) is (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine.
What is the SMILES notation for (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine?
The canonical SMILES for (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine is C[C@@H](N)Cn1ccc2cc(F)c(F)cc21.
What is the InChIKey of (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine?
The InChIKey is MYZDBEVPJGKIQS-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H12F2N2/c1-7(14)6-15-3-2-8-4-9(12)10(13)5-11(8)15/h2-5,7H,6,14H2,1H3/t7-/m1/s1.
What are the key properties of (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine?
(2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine has a molecular weight of 210.23 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(5,6-difluoroindol-1-yl)propan-2-amine is sourced from PubChem (CID 10774796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).