C11H18N2O2S2 — CID 107748086
2-amino-4-(3-methylbutylsulfanyl)benzenesulfonamide (PubChem CID 107748086) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-amino-4-(3-methylbutylsulfanyl)benzenesulfonamide.
| Compound Name | 2-amino-4-(3-methylbutylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107748086 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-amino-4-(3-methylbutylsulfanyl)benzenesulfonamide |
| SMILES | CC(C)CCSc1ccc(S(N)(=O)=O)c(N)c1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-8(2)5-6-16-9-3-4-11(10(12)7-9)17(13,14)15/h3-4,7-8H,5-6,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | BQTMPMWAXNOHNC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|