C15H25NOS — CID 107749022
1-(4-methoxyphenyl)-1-(2-methylbutylsulfanyl)propan-2-amine (PubChem CID 107749022) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1-(2-methylbutylsulfanyl)propan-2-amine.
| Compound Name | 1-(4-methoxyphenyl)-1-(2-methylbutylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 107749022 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-1-(2-methylbutylsulfanyl)propan-2-amine |
| SMILES | CCC(C)CSC(c1ccc(OC)cc1)C(C)N |
| InChI | InChI=1S/C15H25NOS/c1-5-11(2)10-18-15(12(3)16)13-6-8-14(17-4)9-7-13/h6-9,11-12,15H,5,10,16H2,1-4H3 |
| InChIKey | QSDQMLBHASFOQI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |