About 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine
3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine (PubChem CID 10774960) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine |
| PubChem CID | 10774960 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine |
| SMILES | NCCCC1(C2OCCO2)CCCCC1 |
| InChI | InChI=1S/C12H23NO2/c13-8-4-7-12(5-2-1-3-6-12)11-14-9-10-15-11/h11H,1-10,13H2 |
| InChIKey | BOMJITAMLAALOQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine?
The IUPAC name of 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine (CID 10774960) is 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine.
What is the SMILES notation for 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine?
The canonical SMILES for 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine is NCCCC1(C2OCCO2)CCCCC1.
What is the InChIKey of 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine?
The InChIKey is BOMJITAMLAALOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c13-8-4-7-12(5-2-1-3-6-12)11-14-9-10-15-11/h11H,1-10,13H2.
What are the key properties of 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine?
3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine has a molecular weight of 213.32 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(1,3-dioxolan-2-yl)cyclohexyl]propan-1-amine is sourced from PubChem (CID 10774960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).