C12H24OSi — CID 10774968
tert-butyl-[(1R,4R)-4-deuteriocyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 10774968) has the molecular formula C12H24OSi and a molecular weight of 213.42 g/mol. Its IUPAC name is tert-butyl-[(1R,4R)-4-deuteriocyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,4R)-4-deuteriocyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10774968 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 213.42 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | tert-butyl-[(1R,4R)-4-deuteriocyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | [2H][C@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24OSi/c1-12(2,3)14(4,5)13-11-9-7-6-8-10-11/h7,9,11H,6,8,10H2,1-5H3/t11-/m0/s1/i6D/t6-,11- |
| InChIKey | PLPADPABNLKVHY-YWGJFZOMSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|