C12H25NO2 — CID 10775068
(E,2S,3S)-2-aminododec-4-ene-1,3-diol (PubChem CID 10775068) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is (E,2S,3S)-2-aminododec-4-ene-1,3-diol.
| Compound Name | (E,2S,3S)-2-aminododec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 10775068 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (E,2S,3S)-2-aminododec-4-ene-1,3-diol |
| SMILES | CCCCCCC/C=C/[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C12H25NO2/c1-2-3-4-5-6-7-8-9-12(15)11(13)10-14/h8-9,11-12,14-15H,2-7,10,13H2,1H3/b9-8+/t11-,12-/m0/s1 |
| InChIKey | NCNKWPUJUUMFNR-OMJLJAAMSA-N |
| XLogP | 1.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|