C13H22N2O3S — CID 107753290
ethyl 1-methyl-5-(3-methylbutan-2-ylsulfinylmethyl)pyrazole-4-carboxylate (PubChem CID 107753290) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is ethyl 1-methyl-5-(3-methylbutan-2-ylsulfinylmethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-(3-methylbutan-2-ylsulfinylmethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 107753290 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 1-methyl-5-(3-methylbutan-2-ylsulfinylmethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1CS(=O)C(C)C(C)C |
| InChI | InChI=1S/C13H22N2O3S/c1-6-18-13(16)11-7-14-15(5)12(11)8-19(17)10(4)9(2)3/h7,9-10H,6,8H2,1-5H3 |
| InChIKey | HXPMOZUMALECAH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |