C14H21ClN2O2S — CID 107753534
N-(2-amino-4-chlorophenyl)-3-pentylsulfinylpropanamide (PubChem CID 107753534) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-3-pentylsulfinylpropanamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-3-pentylsulfinylpropanamide |
|---|---|
| PubChem CID | 107753534 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-3-pentylsulfinylpropanamide |
| SMILES | CCCCCS(=O)CCC(=O)Nc1ccc(Cl)cc1N |
| InChI | InChI=1S/C14H21ClN2O2S/c1-2-3-4-8-20(19)9-7-14(18)17-13-6-5-11(15)10-12(13)16/h5-6,10H,2-4,7-9,16H2,1H3,(H,17,18) |
| InChIKey | FPKOHTPXTLUFKA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|