C8H12ClNO4 — CID 10775370
(2S,4R)-2-amino-4-[(E)-3-chloroprop-2-enyl]pentanedioic acid (PubChem CID 10775370) has the molecular formula C8H12ClNO4 and a molecular weight of 221.64 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-[(E)-3-chloroprop-2-enyl]pentanedioic acid.
| Compound Name | (2S,4R)-2-amino-4-[(E)-3-chloroprop-2-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 10775370 |
| Molecular Formula | C8H12ClNO4 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2S,4R)-2-amino-4-[(E)-3-chloroprop-2-enyl]pentanedioic acid |
| SMILES | N[C@@H](C[C@@H](C/C=C/Cl)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12ClNO4/c9-3-1-2-5(7(11)12)4-6(10)8(13)14/h1,3,5-6H,2,4,10H2,(H,11,12)(H,13,14)/b3-1+/t5-,6+/m1/s1 |
| InChIKey | TZGPLLGAODQFNE-NQNGVJOPSA-N |
| XLogP | 0.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |