C15H21NS — CID 107754436
3-[2-(3-methylbutan-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine (PubChem CID 107754436) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 3-[2-(3-methylbutan-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[2-(3-methylbutan-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 107754436 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-[2-(3-methylbutan-2-ylsulfanylmethyl)phenyl]prop-2-yn-1-amine |
| SMILES | CC(C)C(C)SCc1ccccc1C#CCN |
| InChI | InChI=1S/C15H21NS/c1-12(2)13(3)17-11-15-8-5-4-7-14(15)9-6-10-16/h4-5,7-8,12-13H,10-11,16H2,1-3H3 |
| InChIKey | JPKVEHZZDGULIU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|