C10H16N4O2 — CID 10775505
3-(2-ethoxyethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole (PubChem CID 10775505) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(2-ethoxyethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10775505 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-(2-ethoxyethyl)-5-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,4-oxadiazole |
| SMILES | CCOCCc1noc(C2CN=CNC2)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-2-15-4-3-9-13-10(16-14-9)8-5-11-7-12-6-8/h7-8H,2-6H2,1H3,(H,11,12) |
| InChIKey | JDDYKFQIIBEOOL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|