C15H27NO3S — CID 107755276
methyl 1-(methylamino)-2-[2-(2-methyloxolan-3-yl)sulfanylethyl]cyclopentane-1-carboxylate (PubChem CID 107755276) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is methyl 1-(methylamino)-2-[2-(2-methyloxolan-3-yl)sulfanylethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(methylamino)-2-[2-(2-methyloxolan-3-yl)sulfanylethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 107755276 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl 1-(methylamino)-2-[2-(2-methyloxolan-3-yl)sulfanylethyl]cyclopentane-1-carboxylate |
| SMILES | CNC1(C(=O)OC)CCCC1CCSC1CCOC1C |
| InChI | InChI=1S/C15H27NO3S/c1-11-13(6-9-19-11)20-10-7-12-5-4-8-15(12,16-2)14(17)18-3/h11-13,16H,4-10H2,1-3H3 |
| InChIKey | BMQNDBWJTDVXGM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |