C12H23NO2S — CID 107756279
methyl 1-amino-3-(3-methylbutylsulfanyl)cyclopentane-1-carboxylate (PubChem CID 107756279) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is methyl 1-amino-3-(3-methylbutylsulfanyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-amino-3-(3-methylbutylsulfanyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 107756279 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl 1-amino-3-(3-methylbutylsulfanyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCC(SCCC(C)C)C1 |
| InChI | InChI=1S/C12H23NO2S/c1-9(2)5-7-16-10-4-6-12(13,8-10)11(14)15-3/h9-10H,4-8,13H2,1-3H3 |
| InChIKey | LGJIPAZOMKYFLS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |