About 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide
5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10775687) has the molecular formula C9H17N5S
and a molecular weight of 227.34 g/mol. Its IUPAC name is 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide.
Molecular Properties
| Compound Name | 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide |
| PubChem CID | 10775687 |
| Molecular Formula | C9H17N5S |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide |
| SMILES | CCCCCCNC(=S)n1ncnc1N |
| InChI | InChI=1S/C9H17N5S/c1-2-3-4-5-6-11-9(15)14-8(10)12-7-13-14/h7H,2-6H2,1H3,(H,11,15)(H2,10,12,13) |
| InChIKey | FCJWVARYJHDXAF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide?
The IUPAC name of 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide (CID 10775687) is 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide.
What is the SMILES notation for 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide?
The canonical SMILES for 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide is CCCCCCNC(=S)n1ncnc1N.
What is the InChIKey of 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide?
The InChIKey is FCJWVARYJHDXAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5S/c1-2-3-4-5-6-11-9(15)14-8(10)12-7-13-14/h7H,2-6H2,1H3,(H,11,15)(H2,10,12,13).
What are the key properties of 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide?
5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide has a molecular weight of 227.34 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-hexyl-1,2,4-triazole-1-carbothioamide is sourced from PubChem (CID 10775687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).