C16H27NO3S — CID 107758662
1-[4-methoxy-3-(pentylsulfonylmethyl)phenyl]-N-methylethanamine (PubChem CID 107758662) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-[4-methoxy-3-(pentylsulfonylmethyl)phenyl]-N-methylethanamine.
| Compound Name | 1-[4-methoxy-3-(pentylsulfonylmethyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 107758662 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-[4-methoxy-3-(pentylsulfonylmethyl)phenyl]-N-methylethanamine |
| SMILES | CCCCCS(=O)(=O)Cc1cc(C(C)NC)ccc1OC |
| InChI | InChI=1S/C16H27NO3S/c1-5-6-7-10-21(18,19)12-15-11-14(13(2)17-3)8-9-16(15)20-4/h8-9,11,13,17H,5-7,10,12H2,1-4H3 |
| InChIKey | WRTPVBNYTOKRCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|